C40H48F2O5 — CID 102518916
[2-fluoro-4-[2-[4-[(2R)-octan-2-yl]oxycarbonylphenyl]ethynyl]phenyl] 4-decoxy-3-fluorobenzoate (PubChem CID 102518916) has the molecular formula C40H48F2O5 and a molecular weight of 646.82 g/mol. Its IUPAC name is [2-fluoro-4-[2-[4-[(2R)-octan-2-yl]oxycarbonylphenyl]ethynyl]phenyl] 4-decoxy-3-fluorobenzoate.
| Compound Name | [2-fluoro-4-[2-[4-[(2R)-octan-2-yl]oxycarbonylphenyl]ethynyl]phenyl] 4-decoxy-3-fluorobenzoate |
|---|---|
| PubChem CID | 102518916 |
| Molecular Formula | C40H48F2O5 |
| Molecular Weight | 646.82 g/mol |
| Exact Mass | 646.35 |
| IUPAC Name | [2-fluoro-4-[2-[4-[(2R)-octan-2-yl]oxycarbonylphenyl]ethynyl]phenyl] 4-decoxy-3-fluorobenzoate |
| SMILES | CCCCCCCCCCOc1ccc(C(=O)Oc2ccc(C#Cc3ccc(C(=O)O[C@H](C)CCCCCC)cc3)cc2F)cc1F |
| InChI | InChI=1S/C40H48F2O5/c1-4-6-8-10-11-12-13-15-27-45-37-26-24-34(29-36(37)42)40(44)47-38-25-21-32(28-35(38)41)18-17-31-19-22-33(23-20-31)39(43)46-30(3)16-14-9-7-5-2/h19-26,28-30H,4-16,27H2,1-3H3/t30-/m1/s1 |
| InChIKey | ANGUQFNVUMUULL-SSEXGKCCSA-N |
| XLogP | 10.62 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 646.82 |
| LogP ≤ 5 | 10.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|