C26H32FNO3 — CID 77380178
(1-cyano-2-methylpropyl) 4-(3-fluoro-4-octoxyphenyl)benzoate (PubChem CID 77380178) has the molecular formula C26H32FNO3 and a molecular weight of 425.54 g/mol. Its IUPAC name is (1-cyano-2-methylpropyl) 4-(3-fluoro-4-octoxyphenyl)benzoate.
| Compound Name | (1-cyano-2-methylpropyl) 4-(3-fluoro-4-octoxyphenyl)benzoate |
|---|---|
| PubChem CID | 77380178 |
| Molecular Formula | C26H32FNO3 |
| Molecular Weight | 425.54 g/mol |
| Exact Mass | 425.24 |
| IUPAC Name | (1-cyano-2-methylpropyl) 4-(3-fluoro-4-octoxyphenyl)benzoate |
| SMILES | CCCCCCCCOc1ccc(-c2ccc(C(=O)OC(C#N)C(C)C)cc2)cc1F |
| InChI | InChI=1S/C26H32FNO3/c1-4-5-6-7-8-9-16-30-24-15-14-22(17-23(24)27)20-10-12-21(13-11-20)26(29)31-25(18-28)19(2)3/h10-15,17,19,25H,4-9,16H2,1-3H3 |
| InChIKey | STKHCLDLMLZNST-UHFFFAOYSA-N |
| XLogP | 6.94 |
| TPSA | 59.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.54 |
| LogP ≤ 5 | 6.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|