C25H29F2NO3 — CID 14512170
(1-cyano-2-methylpropyl) 4-(2,3-difluoro-4-heptoxyphenyl)benzoate (PubChem CID 14512170) has the molecular formula C25H29F2NO3 and a molecular weight of 429.51 g/mol. Its IUPAC name is (1-cyano-2-methylpropyl) 4-(2,3-difluoro-4-heptoxyphenyl)benzoate.
| Compound Name | (1-cyano-2-methylpropyl) 4-(2,3-difluoro-4-heptoxyphenyl)benzoate |
|---|---|
| PubChem CID | 14512170 |
| Molecular Formula | C25H29F2NO3 |
| Molecular Weight | 429.51 g/mol |
| Exact Mass | 429.21 |
| IUPAC Name | (1-cyano-2-methylpropyl) 4-(2,3-difluoro-4-heptoxyphenyl)benzoate |
| SMILES | CCCCCCCOc1ccc(-c2ccc(C(=O)OC(C#N)C(C)C)cc2)c(F)c1F |
| InChI | InChI=1S/C25H29F2NO3/c1-4-5-6-7-8-15-30-21-14-13-20(23(26)24(21)27)18-9-11-19(12-10-18)25(29)31-22(16-28)17(2)3/h9-14,17,22H,4-8,15H2,1-3H3 |
| InChIKey | GWGHSXDTFJKOKU-UHFFFAOYSA-N |
| XLogP | 6.69 |
| TPSA | 59.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.51 |
| LogP ≤ 5 | 6.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|