C24H30F2O4 — CID 23542849
ethyl 4-[2,3-difluoro-4-(4-pentoxybutoxy)phenyl]benzoate (PubChem CID 23542849) has the molecular formula C24H30F2O4 and a molecular weight of 420.50 g/mol. Its IUPAC name is ethyl 4-[2,3-difluoro-4-(4-pentoxybutoxy)phenyl]benzoate.
| Compound Name | ethyl 4-[2,3-difluoro-4-(4-pentoxybutoxy)phenyl]benzoate |
|---|---|
| PubChem CID | 23542849 |
| Molecular Formula | C24H30F2O4 |
| Molecular Weight | 420.50 g/mol |
| Exact Mass | 420.21 |
| IUPAC Name | ethyl 4-[2,3-difluoro-4-(4-pentoxybutoxy)phenyl]benzoate |
| SMILES | CCCCCOCCCCOc1ccc(-c2ccc(C(=O)OCC)cc2)c(F)c1F |
| InChI | InChI=1S/C24H30F2O4/c1-3-5-6-15-28-16-7-8-17-30-21-14-13-20(22(25)23(21)26)18-9-11-19(12-10-18)24(27)29-4-2/h9-14H,3-8,15-17H2,1-2H3 |
| InChIKey | BSNCCBNTNOTJFQ-UHFFFAOYSA-N |
| XLogP | 6.17 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.50 |
| LogP ≤ 5 | 6.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|