C23H25F2NO3 — CID 14512162
1-cyanoethyl 2,3-difluoro-4-(4-heptoxyphenyl)benzoate (PubChem CID 14512162) has the molecular formula C23H25F2NO3 and a molecular weight of 401.45 g/mol. Its IUPAC name is 1-cyanoethyl 2,3-difluoro-4-(4-heptoxyphenyl)benzoate.
| Compound Name | 1-cyanoethyl 2,3-difluoro-4-(4-heptoxyphenyl)benzoate |
|---|---|
| PubChem CID | 14512162 |
| Molecular Formula | C23H25F2NO3 |
| Molecular Weight | 401.45 g/mol |
| Exact Mass | 401.18 |
| IUPAC Name | 1-cyanoethyl 2,3-difluoro-4-(4-heptoxyphenyl)benzoate |
| SMILES | CCCCCCCOc1ccc(-c2ccc(C(=O)OC(C)C#N)c(F)c2F)cc1 |
| InChI | InChI=1S/C23H25F2NO3/c1-3-4-5-6-7-14-28-18-10-8-17(9-11-18)19-12-13-20(22(25)21(19)24)23(27)29-16(2)15-26/h8-13,16H,3-7,14H2,1-2H3 |
| InChIKey | BPTQPVSBSUVOHN-UHFFFAOYSA-N |
| XLogP | 6.05 |
| TPSA | 59.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.45 |
| LogP ≤ 5 | 6.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|