C26H31F5O3 — CID 139786476
3-(trifluoromethyl)nonyl 2,3-difluoro-4-(4-propoxyphenyl)benzoate (PubChem CID 139786476) has the molecular formula C26H31F5O3 and a molecular weight of 486.52 g/mol. Its IUPAC name is 3-(trifluoromethyl)nonyl 2,3-difluoro-4-(4-propoxyphenyl)benzoate.
| Compound Name | 3-(trifluoromethyl)nonyl 2,3-difluoro-4-(4-propoxyphenyl)benzoate |
|---|---|
| PubChem CID | 139786476 |
| Molecular Formula | C26H31F5O3 |
| Molecular Weight | 486.52 g/mol |
| Exact Mass | 486.22 |
| IUPAC Name | 3-(trifluoromethyl)nonyl 2,3-difluoro-4-(4-propoxyphenyl)benzoate |
| SMILES | CCCCCCC(CCOC(=O)c1ccc(-c2ccc(OCCC)cc2)c(F)c1F)C(F)(F)F |
| InChI | InChI=1S/C26H31F5O3/c1-3-5-6-7-8-19(26(29,30)31)15-17-34-25(32)22-14-13-21(23(27)24(22)28)18-9-11-20(12-10-18)33-16-4-2/h9-14,19H,3-8,15-17H2,1-2H3 |
| InChIKey | AJULWJSLOMKUHG-UHFFFAOYSA-N |
| XLogP | 8.12 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.52 |
| LogP ≤ 5 | 8.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|