C24H27F5O2 — CID 139786521
1,1,1-trifluorohexan-2-yl 2,3-difluoro-4-(4-pentylphenyl)benzoate (PubChem CID 139786521) has the molecular formula C24H27F5O2 and a molecular weight of 442.47 g/mol. Its IUPAC name is 1,1,1-trifluorohexan-2-yl 2,3-difluoro-4-(4-pentylphenyl)benzoate.
| Compound Name | 1,1,1-trifluorohexan-2-yl 2,3-difluoro-4-(4-pentylphenyl)benzoate |
|---|---|
| PubChem CID | 139786521 |
| Molecular Formula | C24H27F5O2 |
| Molecular Weight | 442.47 g/mol |
| Exact Mass | 442.19 |
| IUPAC Name | 1,1,1-trifluorohexan-2-yl 2,3-difluoro-4-(4-pentylphenyl)benzoate |
| SMILES | CCCCCc1ccc(-c2ccc(C(=O)OC(CCCC)C(F)(F)F)c(F)c2F)cc1 |
| InChI | InChI=1S/C24H27F5O2/c1-3-5-7-8-16-10-12-17(13-11-16)18-14-15-19(22(26)21(18)25)23(30)31-20(9-6-4-2)24(27,28)29/h10-15,20H,3-9H2,1-2H3 |
| InChIKey | WUCSUAPOMCYXKD-UHFFFAOYSA-N |
| XLogP | 7.64 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.47 |
| LogP ≤ 5 | 7.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|