C26H31F5O2 — CID 139786458
1,1,1-trifluoropentan-2-yl 2,3-difluoro-4-(4-octylphenyl)benzoate (PubChem CID 139786458) has the molecular formula C26H31F5O2 and a molecular weight of 470.52 g/mol. Its IUPAC name is 1,1,1-trifluoropentan-2-yl 2,3-difluoro-4-(4-octylphenyl)benzoate.
| Compound Name | 1,1,1-trifluoropentan-2-yl 2,3-difluoro-4-(4-octylphenyl)benzoate |
|---|---|
| PubChem CID | 139786458 |
| Molecular Formula | C26H31F5O2 |
| Molecular Weight | 470.52 g/mol |
| Exact Mass | 470.22 |
| IUPAC Name | 1,1,1-trifluoropentan-2-yl 2,3-difluoro-4-(4-octylphenyl)benzoate |
| SMILES | CCCCCCCCc1ccc(-c2ccc(C(=O)OC(CCC)C(F)(F)F)c(F)c2F)cc1 |
| InChI | InChI=1S/C26H31F5O2/c1-3-5-6-7-8-9-11-18-12-14-19(15-13-18)20-16-17-21(24(28)23(20)27)25(32)33-22(10-4-2)26(29,30)31/h12-17,22H,3-11H2,1-2H3 |
| InChIKey | HMVVZBMNRCTPQP-UHFFFAOYSA-N |
| XLogP | 8.42 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.52 |
| LogP ≤ 5 | 8.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|