C25H29F5O3 — CID 139786508
3-(trifluoromethyl)nonyl 4-(4-ethoxyphenyl)-2,3-difluorobenzoate (PubChem CID 139786508) has the molecular formula C25H29F5O3 and a molecular weight of 472.49 g/mol. Its IUPAC name is 3-(trifluoromethyl)nonyl 4-(4-ethoxyphenyl)-2,3-difluorobenzoate.
| Compound Name | 3-(trifluoromethyl)nonyl 4-(4-ethoxyphenyl)-2,3-difluorobenzoate |
|---|---|
| PubChem CID | 139786508 |
| Molecular Formula | C25H29F5O3 |
| Molecular Weight | 472.49 g/mol |
| Exact Mass | 472.20 |
| IUPAC Name | 3-(trifluoromethyl)nonyl 4-(4-ethoxyphenyl)-2,3-difluorobenzoate |
| SMILES | CCCCCCC(CCOC(=O)c1ccc(-c2ccc(OCC)cc2)c(F)c1F)C(F)(F)F |
| InChI | InChI=1S/C25H29F5O3/c1-3-5-6-7-8-18(25(28,29)30)15-16-33-24(31)21-14-13-20(22(26)23(21)27)17-9-11-19(12-10-17)32-4-2/h9-14,18H,3-8,15-16H2,1-2H3 |
| InChIKey | OTBSCUGDTDZRTL-UHFFFAOYSA-N |
| XLogP | 7.73 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.49 |
| LogP ≤ 5 | 7.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|