About [4-(4-nonylcyclohexyl)cyclohexyl] 3-chloro-4-hexylbenzoate
[4-(4-nonylcyclohexyl)cyclohexyl] 3-chloro-4-hexylbenzoate (PubChem CID 19846828) has the molecular formula C34H55ClO2
and a molecular weight of 531.27 g/mol. Its IUPAC name is [4-(4-nonylcyclohexyl)cyclohexyl] 3-chloro-4-hexylbenzoate.
Molecular Properties
| Compound Name | [4-(4-nonylcyclohexyl)cyclohexyl] 3-chloro-4-hexylbenzoate |
| PubChem CID | 19846828 |
| Molecular Formula | C34H55ClO2 |
| Molecular Weight | 531.27 g/mol |
| Exact Mass | 530.39 |
| IUPAC Name | [4-(4-nonylcyclohexyl)cyclohexyl] 3-chloro-4-hexylbenzoate |
| SMILES | CCCCCCCCCC1CCC(C2CCC(OC(=O)c3ccc(CCCCCC)c(Cl)c3)CC2)CC1 |
| InChI | InChI=1S/C34H55ClO2/c1-3-5-7-9-10-11-12-14-27-16-18-28(19-17-27)29-22-24-32(25-23-29)37-34(36)31-21-20-30(33(35)26-31)15-13-8-6-4-2/h20-21,26-29,32H,3-19,22-25H2,1-2H3 |
| InChIKey | CQZMIXLAIWXJCQ-UHFFFAOYSA-N |
| XLogP | 11.13 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 37 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 531.27 |
| LogP ≤ 5 | 11.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze [4-(4-nonylcyclohexyl)cyclohexyl] 3-chloro-4-hexylbenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-(4-nonylcyclohexyl)cyclohexyl] 3-chloro-4-hexylbenzoate?
The IUPAC name of [4-(4-nonylcyclohexyl)cyclohexyl] 3-chloro-4-hexylbenzoate (CID 19846828) is [4-(4-nonylcyclohexyl)cyclohexyl] 3-chloro-4-hexylbenzoate.
What is the SMILES notation for [4-(4-nonylcyclohexyl)cyclohexyl] 3-chloro-4-hexylbenzoate?
The canonical SMILES for [4-(4-nonylcyclohexyl)cyclohexyl] 3-chloro-4-hexylbenzoate is CCCCCCCCCC1CCC(C2CCC(OC(=O)c3ccc(CCCCCC)c(Cl)c3)CC2)CC1.
What is the InChIKey of [4-(4-nonylcyclohexyl)cyclohexyl] 3-chloro-4-hexylbenzoate?
The InChIKey is CQZMIXLAIWXJCQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C34H55ClO2/c1-3-5-7-9-10-11-12-14-27-16-18-28(19-17-27)29-22-24-32(25-23-29)37-34(36)31-21-20-30(33(35)26-31)15-13-8-6-4-2/h20-21,26-29,32H,3-19,22-25H2,1-2H3.
What are the key properties of [4-(4-nonylcyclohexyl)cyclohexyl] 3-chloro-4-hexylbenzoate?
[4-(4-nonylcyclohexyl)cyclohexyl] 3-chloro-4-hexylbenzoate has a molecular weight of 531.27 g/mol, XLogP of 11.13, 16 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for [4-(4-nonylcyclohexyl)cyclohexyl] 3-chloro-4-hexylbenzoate is sourced from PubChem (CID 19846828), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).