C33H44F4O2 — CID 70177031
1-(difluoromethoxy)-4-[difluoro-[4-[2-[4-(4-pentylcyclohexyl)cyclohexyl]ethyl]phenyl]methoxy]benzene (PubChem CID 70177031) has the molecular formula C33H44F4O2 and a molecular weight of 548.71 g/mol. Its IUPAC name is 1-(difluoromethoxy)-4-[difluoro-[4-[2-[4-(4-pentylcyclohexyl)cyclohexyl]ethyl]phenyl]methoxy]benzene.
| Compound Name | 1-(difluoromethoxy)-4-[difluoro-[4-[2-[4-(4-pentylcyclohexyl)cyclohexyl]ethyl]phenyl]methoxy]benzene |
|---|---|
| PubChem CID | 70177031 |
| Molecular Formula | C33H44F4O2 |
| Molecular Weight | 548.71 g/mol |
| Exact Mass | 548.33 |
| IUPAC Name | 1-(difluoromethoxy)-4-[difluoro-[4-[2-[4-(4-pentylcyclohexyl)cyclohexyl]ethyl]phenyl]methoxy]benzene |
| SMILES | CCCCCC1CCC(C2CCC(CCc3ccc(C(F)(F)Oc4ccc(OC(F)F)cc4)cc3)CC2)CC1 |
| InChI | InChI=1S/C33H44F4O2/c1-2-3-4-5-24-8-14-27(15-9-24)28-16-10-25(11-17-28)6-7-26-12-18-29(19-13-26)33(36,37)39-31-22-20-30(21-23-31)38-32(34)35/h12-13,18-25,27-28,32H,2-11,14-17H2,1H3 |
| InChIKey | DNQRHLVMFDRIKA-UHFFFAOYSA-N |
| XLogP | 10.54 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.71 |
| LogP ≤ 5 | 10.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|