C26H42F2OSi — CID 54323999
1-butyl-4-[4-[4-[4-(difluoromethoxy)phenyl]butyl]cyclohexyl]silinane (PubChem CID 54323999) has the molecular formula C26H42F2OSi and a molecular weight of 436.70 g/mol. Its IUPAC name is 1-butyl-4-[4-[4-[4-(difluoromethoxy)phenyl]butyl]cyclohexyl]silinane.
| Compound Name | 1-butyl-4-[4-[4-[4-(difluoromethoxy)phenyl]butyl]cyclohexyl]silinane |
|---|---|
| PubChem CID | 54323999 |
| Molecular Formula | C26H42F2OSi |
| Molecular Weight | 436.70 g/mol |
| Exact Mass | 436.30 |
| IUPAC Name | 1-butyl-4-[4-[4-[4-(difluoromethoxy)phenyl]butyl]cyclohexyl]silinane |
| SMILES | CCCC[SiH]1CCC(C2CCC(CCCCc3ccc(OC(F)F)cc3)CC2)CC1 |
| InChI | InChI=1S/C26H42F2OSi/c1-2-3-18-30-19-16-24(17-20-30)23-12-8-21(9-13-23)6-4-5-7-22-10-14-25(15-11-22)29-26(27)28/h10-11,14-15,21,23-24,26,30H,2-9,12-13,16-20H2,1H3 |
| InChIKey | STPYYFUJYNQCOJ-UHFFFAOYSA-N |
| XLogP | 8.24 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.70 |
| LogP ≤ 5 | 8.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|