C26H42F2Si — CID 54734202
4-[4-[4-(3,4-difluorophenyl)butyl]cyclohexyl]-1-pentylsilinane (PubChem CID 54734202) has the molecular formula C26H42F2Si and a molecular weight of 420.70 g/mol. Its IUPAC name is 4-[4-[4-(3,4-difluorophenyl)butyl]cyclohexyl]-1-pentylsilinane.
| Compound Name | 4-[4-[4-(3,4-difluorophenyl)butyl]cyclohexyl]-1-pentylsilinane |
|---|---|
| PubChem CID | 54734202 |
| Molecular Formula | C26H42F2Si |
| Molecular Weight | 420.70 g/mol |
| Exact Mass | 420.30 |
| IUPAC Name | 4-[4-[4-(3,4-difluorophenyl)butyl]cyclohexyl]-1-pentylsilinane |
| SMILES | CCCCC[SiH]1CCC(C2CCC(CCCCc3ccc(F)c(F)c3)CC2)CC1 |
| InChI | InChI=1S/C26H42F2Si/c1-2-3-6-17-29-18-15-24(16-19-29)23-12-9-21(10-13-23)7-4-5-8-22-11-14-25(27)26(28)20-22/h11,14,20-21,23-24,29H,2-10,12-13,15-19H2,1H3 |
| InChIKey | HHRPWAVCGBNIJL-UHFFFAOYSA-N |
| XLogP | 8.31 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.70 |
| LogP ≤ 5 | 8.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|