C28H41BrF4 — CID 20654014
2-[bromo(difluoro)methyl]-1,3-difluoro-5-[4-[4-(4-pentylcyclohexyl)cyclohexyl]butyl]benzene (PubChem CID 20654014) has the molecular formula C28H41BrF4 and a molecular weight of 533.53 g/mol. Its IUPAC name is 2-[bromo(difluoro)methyl]-1,3-difluoro-5-[4-[4-(4-pentylcyclohexyl)cyclohexyl]butyl]benzene.
| Compound Name | 2-[bromo(difluoro)methyl]-1,3-difluoro-5-[4-[4-(4-pentylcyclohexyl)cyclohexyl]butyl]benzene |
|---|---|
| PubChem CID | 20654014 |
| Molecular Formula | C28H41BrF4 |
| Molecular Weight | 533.53 g/mol |
| Exact Mass | 532.23 |
| IUPAC Name | 2-[bromo(difluoro)methyl]-1,3-difluoro-5-[4-[4-(4-pentylcyclohexyl)cyclohexyl]butyl]benzene |
| SMILES | CCCCCC1CCC(C2CCC(CCCCc3cc(F)c(C(F)(F)Br)c(F)c3)CC2)CC1 |
| InChI | InChI=1S/C28H41BrF4/c1-2-3-4-7-20-10-14-23(15-11-20)24-16-12-21(13-17-24)8-5-6-9-22-18-25(30)27(26(31)19-22)28(29,32)33/h18-21,23-24H,2-17H2,1H3 |
| InChIKey | SMAKHCZKLFIRKR-UHFFFAOYSA-N |
| XLogP | 10.31 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.53 |
| LogP ≤ 5 | 10.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|