C25H35ClF4O — CID 20654091
2-[chloro(difluoro)methyl]-1,3-difluoro-5-[4-[4-[4-(methoxymethyl)cyclohexyl]cyclohexyl]butyl]benzene (PubChem CID 20654091) has the molecular formula C25H35ClF4O and a molecular weight of 463.00 g/mol. Its IUPAC name is 2-[chloro(difluoro)methyl]-1,3-difluoro-5-[4-[4-[4-(methoxymethyl)cyclohexyl]cyclohexyl]butyl]benzene.
| Compound Name | 2-[chloro(difluoro)methyl]-1,3-difluoro-5-[4-[4-[4-(methoxymethyl)cyclohexyl]cyclohexyl]butyl]benzene |
|---|---|
| PubChem CID | 20654091 |
| Molecular Formula | C25H35ClF4O |
| Molecular Weight | 463.00 g/mol |
| Exact Mass | 462.23 |
| IUPAC Name | 2-[chloro(difluoro)methyl]-1,3-difluoro-5-[4-[4-[4-(methoxymethyl)cyclohexyl]cyclohexyl]butyl]benzene |
| SMILES | COCC1CCC(C2CCC(CCCCc3cc(F)c(C(F)(F)Cl)c(F)c3)CC2)CC1 |
| InChI | InChI=1S/C25H35ClF4O/c1-31-16-18-8-12-21(13-9-18)20-10-6-17(7-11-20)4-2-3-5-19-14-22(27)24(23(28)15-19)25(26,29)30/h14-15,17-18,20-21H,2-13,16H2,1H3 |
| InChIKey | STLXTOSIHFKRKF-UHFFFAOYSA-N |
| XLogP | 8.22 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.00 |
| LogP ≤ 5 | 8.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|