C32H37ClF6 — CID 20653912
2-[chloro(difluoro)methyl]-5-[2,6-difluoro-4-[2-[4-[4-[(E)-pent-3-enyl]cyclohexyl]cyclohexyl]ethyl]phenyl]-1,3-difluorobenzene (PubChem CID 20653912) has the molecular formula C32H37ClF6 and a molecular weight of 571.09 g/mol. Its IUPAC name is 2-[chloro(difluoro)methyl]-5-[2,6-difluoro-4-[2-[4-[4-[(E)-pent-3-enyl]cyclohexyl]cyclohexyl]ethyl]phenyl]-1,3-difluorobenzene.
| Compound Name | 2-[chloro(difluoro)methyl]-5-[2,6-difluoro-4-[2-[4-[4-[(E)-pent-3-enyl]cyclohexyl]cyclohexyl]ethyl]phenyl]-1,3-difluorobenzene |
|---|---|
| PubChem CID | 20653912 |
| Molecular Formula | C32H37ClF6 |
| Molecular Weight | 571.09 g/mol |
| Exact Mass | 570.25 |
| IUPAC Name | 2-[chloro(difluoro)methyl]-5-[2,6-difluoro-4-[2-[4-[4-[(E)-pent-3-enyl]cyclohexyl]cyclohexyl]ethyl]phenyl]-1,3-difluorobenzene |
| SMILES | C/C=C/CCC1CCC(C2CCC(CCc3cc(F)c(-c4cc(F)c(C(F)(F)Cl)c(F)c4)c(F)c3)CC2)CC1 |
| InChI | InChI=1S/C32H37ClF6/c1-2-3-4-5-20-8-12-23(13-9-20)24-14-10-21(11-15-24)6-7-22-16-26(34)30(27(35)17-22)25-18-28(36)31(29(37)19-25)32(33,38)39/h2-3,16-21,23-24H,4-15H2,1H3/b3-2+ |
| InChIKey | LVDDRXKNTAXJTR-NSCUHMNNSA-N |
| XLogP | 11.10 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 571.09 |
| LogP ≤ 5 | 11.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|