C19H23F5 — CID 67589559
5-[2-[4-[(E)-but-2-enyl]cyclohexyl]ethyl]-1,3-difluoro-2-(trifluoromethyl)benzene (PubChem CID 67589559) has the molecular formula C19H23F5 and a molecular weight of 346.38 g/mol. Its IUPAC name is 5-[2-[4-[(E)-but-2-enyl]cyclohexyl]ethyl]-1,3-difluoro-2-(trifluoromethyl)benzene.
| Compound Name | 5-[2-[4-[(E)-but-2-enyl]cyclohexyl]ethyl]-1,3-difluoro-2-(trifluoromethyl)benzene |
|---|---|
| PubChem CID | 67589559 |
| Molecular Formula | C19H23F5 |
| Molecular Weight | 346.38 g/mol |
| Exact Mass | 346.17 |
| IUPAC Name | 5-[2-[4-[(E)-but-2-enyl]cyclohexyl]ethyl]-1,3-difluoro-2-(trifluoromethyl)benzene |
| SMILES | C/C=C/CC1CCC(CCc2cc(F)c(C(F)(F)F)c(F)c2)CC1 |
| InChI | InChI=1S/C19H23F5/c1-2-3-4-13-5-7-14(8-6-13)9-10-15-11-16(20)18(17(21)12-15)19(22,23)24/h2-3,11-14H,4-10H2,1H3/b3-2+ |
| InChIKey | GXDFHRFAKVDQRZ-NSCUHMNNSA-N |
| XLogP | 6.69 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.38 |
| LogP ≤ 5 | 6.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|