C23H31F5 — CID 54550243
1,3-difluoro-5-[2-(4-oct-4-enylcyclohexyl)ethyl]-2-(trifluoromethyl)benzene (PubChem CID 54550243) has the molecular formula C23H31F5 and a molecular weight of 402.49 g/mol. Its IUPAC name is 1,3-difluoro-5-[2-(4-oct-4-enylcyclohexyl)ethyl]-2-(trifluoromethyl)benzene.
| Compound Name | 1,3-difluoro-5-[2-(4-oct-4-enylcyclohexyl)ethyl]-2-(trifluoromethyl)benzene |
|---|---|
| PubChem CID | 54550243 |
| Molecular Formula | C23H31F5 |
| Molecular Weight | 402.49 g/mol |
| Exact Mass | 402.23 |
| IUPAC Name | 1,3-difluoro-5-[2-(4-oct-4-enylcyclohexyl)ethyl]-2-(trifluoromethyl)benzene |
| SMILES | CCCC=CCCCC1CCC(CCc2cc(F)c(C(F)(F)F)c(F)c2)CC1 |
| InChI | InChI=1S/C23H31F5/c1-2-3-4-5-6-7-8-17-9-11-18(12-10-17)13-14-19-15-20(24)22(21(25)16-19)23(26,27)28/h4-5,15-18H,2-3,6-14H2,1H3 |
| InChIKey | ZJJNFZVPLFRYRF-UHFFFAOYSA-N |
| XLogP | 8.25 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.49 |
| LogP ≤ 5 | 8.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|