C22H29F5O — CID 67588690
1,3-difluoro-5-[2-[4-[(E)-hept-4-enyl]cyclohexyl]ethyl]-2-(trifluoromethoxy)benzene (PubChem CID 67588690) has the molecular formula C22H29F5O and a molecular weight of 404.46 g/mol. Its IUPAC name is 1,3-difluoro-5-[2-[4-[(E)-hept-4-enyl]cyclohexyl]ethyl]-2-(trifluoromethoxy)benzene.
| Compound Name | 1,3-difluoro-5-[2-[4-[(E)-hept-4-enyl]cyclohexyl]ethyl]-2-(trifluoromethoxy)benzene |
|---|---|
| PubChem CID | 67588690 |
| Molecular Formula | C22H29F5O |
| Molecular Weight | 404.46 g/mol |
| Exact Mass | 404.21 |
| IUPAC Name | 1,3-difluoro-5-[2-[4-[(E)-hept-4-enyl]cyclohexyl]ethyl]-2-(trifluoromethoxy)benzene |
| SMILES | CC/C=C/CCCC1CCC(CCc2cc(F)c(OC(F)(F)F)c(F)c2)CC1 |
| InChI | InChI=1S/C22H29F5O/c1-2-3-4-5-6-7-16-8-10-17(11-9-16)12-13-18-14-19(23)21(20(24)15-18)28-22(25,26)27/h3-4,14-17H,2,5-13H2,1H3/b4-3+ |
| InChIKey | UUOCPNPFGUBLJF-ONEGZZNKSA-N |
| XLogP | 7.74 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.46 |
| LogP ≤ 5 | 7.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|