C28H39F5 — CID 67589693
1,3-difluoro-5-[2-[4-[4-[(E)-hept-4-enyl]cyclohexyl]cyclohexyl]ethyl]-2-(trifluoromethyl)benzene (PubChem CID 67589693) has the molecular formula C28H39F5 and a molecular weight of 470.61 g/mol. Its IUPAC name is 1,3-difluoro-5-[2-[4-[4-[(E)-hept-4-enyl]cyclohexyl]cyclohexyl]ethyl]-2-(trifluoromethyl)benzene.
| Compound Name | 1,3-difluoro-5-[2-[4-[4-[(E)-hept-4-enyl]cyclohexyl]cyclohexyl]ethyl]-2-(trifluoromethyl)benzene |
|---|---|
| PubChem CID | 67589693 |
| Molecular Formula | C28H39F5 |
| Molecular Weight | 470.61 g/mol |
| Exact Mass | 470.30 |
| IUPAC Name | 1,3-difluoro-5-[2-[4-[4-[(E)-hept-4-enyl]cyclohexyl]cyclohexyl]ethyl]-2-(trifluoromethyl)benzene |
| SMILES | CC/C=C/CCCC1CCC(C2CCC(CCc3cc(F)c(C(F)(F)F)c(F)c3)CC2)CC1 |
| InChI | InChI=1S/C28H39F5/c1-2-3-4-5-6-7-20-10-14-23(15-11-20)24-16-12-21(13-17-24)8-9-22-18-25(29)27(26(30)19-22)28(31,32)33/h3-4,18-21,23-24H,2,5-17H2,1H3/b4-3+ |
| InChIKey | CKPFEZDVMGEZOL-ONEGZZNKSA-N |
| XLogP | 9.67 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.61 |
| LogP ≤ 5 | 9.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|