C19H22F6 — CID 19695329
1,3-difluoro-5-[2-[4-[(E)-4-fluorobut-1-enyl]cyclohexyl]ethyl]-2-(trifluoromethyl)benzene (PubChem CID 19695329) has the molecular formula C19H22F6 and a molecular weight of 364.37 g/mol. Its IUPAC name is 1,3-difluoro-5-[2-[4-[(E)-4-fluorobut-1-enyl]cyclohexyl]ethyl]-2-(trifluoromethyl)benzene.
| Compound Name | 1,3-difluoro-5-[2-[4-[(E)-4-fluorobut-1-enyl]cyclohexyl]ethyl]-2-(trifluoromethyl)benzene |
|---|---|
| PubChem CID | 19695329 |
| Molecular Formula | C19H22F6 |
| Molecular Weight | 364.37 g/mol |
| Exact Mass | 364.16 |
| IUPAC Name | 1,3-difluoro-5-[2-[4-[(E)-4-fluorobut-1-enyl]cyclohexyl]ethyl]-2-(trifluoromethyl)benzene |
| SMILES | FCC/C=C/C1CCC(CCc2cc(F)c(C(F)(F)F)c(F)c2)CC1 |
| InChI | InChI=1S/C19H22F6/c20-10-2-1-3-13-4-6-14(7-5-13)8-9-15-11-16(21)18(17(22)12-15)19(23,24)25/h1,3,11-14H,2,4-10H2/b3-1+ |
| InChIKey | BMZDPFBENAIRTR-HNQUOIGGSA-N |
| XLogP | 6.64 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.37 |
| LogP ≤ 5 | 6.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|