C20H27BrF4 — CID 20653978
2-[bromo(difluoro)methyl]-1,3-difluoro-5-[2-(4-pentylcyclohexyl)ethyl]benzene (PubChem CID 20653978) has the molecular formula C20H27BrF4 and a molecular weight of 423.33 g/mol. Its IUPAC name is 2-[bromo(difluoro)methyl]-1,3-difluoro-5-[2-(4-pentylcyclohexyl)ethyl]benzene.
| Compound Name | 2-[bromo(difluoro)methyl]-1,3-difluoro-5-[2-(4-pentylcyclohexyl)ethyl]benzene |
|---|---|
| PubChem CID | 20653978 |
| Molecular Formula | C20H27BrF4 |
| Molecular Weight | 423.33 g/mol |
| Exact Mass | 422.12 |
| IUPAC Name | 2-[bromo(difluoro)methyl]-1,3-difluoro-5-[2-(4-pentylcyclohexyl)ethyl]benzene |
| SMILES | CCCCCC1CCC(CCc2cc(F)c(C(F)(F)Br)c(F)c2)CC1 |
| InChI | InChI=1S/C20H27BrF4/c1-2-3-4-5-14-6-8-15(9-7-14)10-11-16-12-17(22)19(18(23)13-16)20(21,24)25/h12-15H,2-11H2,1H3 |
| InChIKey | AIPMGQRHKDRPRB-UHFFFAOYSA-N |
| XLogP | 7.73 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.33 |
| LogP ≤ 5 | 7.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|