C22H30F4 — CID 59247420
2-fluoro-4-[2-(4-pentylcyclohexyl)ethyl]-1-[(E)-3,3,3-trifluoroprop-1-enyl]benzene (PubChem CID 59247420) has the molecular formula C22H30F4 and a molecular weight of 370.47 g/mol. Its IUPAC name is 2-fluoro-4-[2-(4-pentylcyclohexyl)ethyl]-1-[(E)-3,3,3-trifluoroprop-1-enyl]benzene.
| Compound Name | 2-fluoro-4-[2-(4-pentylcyclohexyl)ethyl]-1-[(E)-3,3,3-trifluoroprop-1-enyl]benzene |
|---|---|
| PubChem CID | 59247420 |
| Molecular Formula | C22H30F4 |
| Molecular Weight | 370.47 g/mol |
| Exact Mass | 370.23 |
| IUPAC Name | 2-fluoro-4-[2-(4-pentylcyclohexyl)ethyl]-1-[(E)-3,3,3-trifluoroprop-1-enyl]benzene |
| SMILES | CCCCCC1CCC(CCc2ccc(/C=C/C(F)(F)F)c(F)c2)CC1 |
| InChI | InChI=1S/C22H30F4/c1-2-3-4-5-17-6-8-18(9-7-17)10-11-19-12-13-20(21(23)16-19)14-15-22(24,25)26/h12-18H,2-11H2,1H3/b15-14+ |
| InChIKey | APMNANQAQDOUAK-CCEZHUSRSA-N |
| XLogP | 7.72 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.47 |
| LogP ≤ 5 | 7.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|