C28H40F4 — CID 59247524
2-fluoro-4-[4-[2-(4-pentylcyclohexyl)ethyl]cyclohexyl]-1-[(E)-3,3,3-trifluoroprop-1-enyl]benzene (PubChem CID 59247524) has the molecular formula C28H40F4 and a molecular weight of 452.62 g/mol. Its IUPAC name is 2-fluoro-4-[4-[2-(4-pentylcyclohexyl)ethyl]cyclohexyl]-1-[(E)-3,3,3-trifluoroprop-1-enyl]benzene.
| Compound Name | 2-fluoro-4-[4-[2-(4-pentylcyclohexyl)ethyl]cyclohexyl]-1-[(E)-3,3,3-trifluoroprop-1-enyl]benzene |
|---|---|
| PubChem CID | 59247524 |
| Molecular Formula | C28H40F4 |
| Molecular Weight | 452.62 g/mol |
| Exact Mass | 452.31 |
| IUPAC Name | 2-fluoro-4-[4-[2-(4-pentylcyclohexyl)ethyl]cyclohexyl]-1-[(E)-3,3,3-trifluoroprop-1-enyl]benzene |
| SMILES | CCCCCC1CCC(CCC2CCC(c3ccc(/C=C/C(F)(F)F)c(F)c3)CC2)CC1 |
| InChI | InChI=1S/C28H40F4/c1-2-3-4-5-21-6-8-22(9-7-21)10-11-23-12-14-24(15-13-23)26-17-16-25(27(29)20-26)18-19-28(30,31)32/h16-24H,2-15H2,1H3/b19-18+ |
| InChIKey | VKVLCXQZMDHWLN-VHEBQXMUSA-N |
| XLogP | 9.84 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.62 |
| LogP ≤ 5 | 9.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|