C27H37F5 — CID 59247357
1,3-difluoro-5-[4-(4-hexylcyclohexyl)cyclohexyl]-2-[(E)-3,3,3-trifluoroprop-1-enyl]benzene (PubChem CID 59247357) has the molecular formula C27H37F5 and a molecular weight of 456.58 g/mol. Its IUPAC name is 1,3-difluoro-5-[4-(4-hexylcyclohexyl)cyclohexyl]-2-[(E)-3,3,3-trifluoroprop-1-enyl]benzene.
| Compound Name | 1,3-difluoro-5-[4-(4-hexylcyclohexyl)cyclohexyl]-2-[(E)-3,3,3-trifluoroprop-1-enyl]benzene |
|---|---|
| PubChem CID | 59247357 |
| Molecular Formula | C27H37F5 |
| Molecular Weight | 456.58 g/mol |
| Exact Mass | 456.28 |
| IUPAC Name | 1,3-difluoro-5-[4-(4-hexylcyclohexyl)cyclohexyl]-2-[(E)-3,3,3-trifluoroprop-1-enyl]benzene |
| SMILES | CCCCCCC1CCC(C2CCC(c3cc(F)c(/C=C/C(F)(F)F)c(F)c3)CC2)CC1 |
| InChI | InChI=1S/C27H37F5/c1-2-3-4-5-6-19-7-9-20(10-8-19)21-11-13-22(14-12-21)23-17-25(28)24(26(29)18-23)15-16-27(30,31)32/h15-22H,2-14H2,1H3/b16-15+ |
| InChIKey | BAGCOTHVULYUOQ-FOCLMDBBSA-N |
| XLogP | 9.59 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.58 |
| LogP ≤ 5 | 9.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|