C24H24F6O — CID 58077480
5-[(E)-1,1-difluoro-3-[2-fluoro-4-(4-propylcyclohexyl)phenyl]prop-2-enoxy]-1,2,3-trifluorobenzene (PubChem CID 58077480) has the molecular formula C24H24F6O and a molecular weight of 442.44 g/mol. Its IUPAC name is 5-[(E)-1,1-difluoro-3-[2-fluoro-4-(4-propylcyclohexyl)phenyl]prop-2-enoxy]-1,2,3-trifluorobenzene.
| Compound Name | 5-[(E)-1,1-difluoro-3-[2-fluoro-4-(4-propylcyclohexyl)phenyl]prop-2-enoxy]-1,2,3-trifluorobenzene |
|---|---|
| PubChem CID | 58077480 |
| Molecular Formula | C24H24F6O |
| Molecular Weight | 442.44 g/mol |
| Exact Mass | 442.17 |
| IUPAC Name | 5-[(E)-1,1-difluoro-3-[2-fluoro-4-(4-propylcyclohexyl)phenyl]prop-2-enoxy]-1,2,3-trifluorobenzene |
| SMILES | CCCC1CCC(c2ccc(/C=C/C(F)(F)Oc3cc(F)c(F)c(F)c3)c(F)c2)CC1 |
| InChI | InChI=1S/C24H24F6O/c1-2-3-15-4-6-16(7-5-15)18-9-8-17(20(25)12-18)10-11-24(29,30)31-19-13-21(26)23(28)22(27)14-19/h8-16H,2-7H2,1H3/b11-10+ |
| InChIKey | OCFMOOYKQMJWEZ-ZHACJKMWSA-N |
| XLogP | 8.00 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.44 |
| LogP ≤ 5 | 8.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|