C26H24F4 — CID 59247457
2-fluoro-4-[4-(4-pentylphenyl)phenyl]-1-[(E)-3,3,3-trifluoroprop-1-enyl]benzene (PubChem CID 59247457) has the molecular formula C26H24F4 and a molecular weight of 412.47 g/mol. Its IUPAC name is 2-fluoro-4-[4-(4-pentylphenyl)phenyl]-1-[(E)-3,3,3-trifluoroprop-1-enyl]benzene.
| Compound Name | 2-fluoro-4-[4-(4-pentylphenyl)phenyl]-1-[(E)-3,3,3-trifluoroprop-1-enyl]benzene |
|---|---|
| PubChem CID | 59247457 |
| Molecular Formula | C26H24F4 |
| Molecular Weight | 412.47 g/mol |
| Exact Mass | 412.18 |
| IUPAC Name | 2-fluoro-4-[4-(4-pentylphenyl)phenyl]-1-[(E)-3,3,3-trifluoroprop-1-enyl]benzene |
| SMILES | CCCCCc1ccc(-c2ccc(-c3ccc(/C=C/C(F)(F)F)c(F)c3)cc2)cc1 |
| InChI | InChI=1S/C26H24F4/c1-2-3-4-5-19-6-8-20(9-7-19)21-10-12-22(13-11-21)24-15-14-23(25(27)18-24)16-17-26(28,29)30/h6-18H,2-5H2,1H3/b17-16+ |
| InChIKey | USNKCHNQIDLNHU-WUKNDPDISA-N |
| XLogP | 8.47 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.47 |
| LogP ≤ 5 | 8.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|