C28H25F7 — CID 59247155
2-[3,5-difluoro-4-[(E)-3,3,3-trifluoroprop-1-enyl]phenyl]-1,3-difluoro-5-(4-heptylphenyl)benzene (PubChem CID 59247155) has the molecular formula C28H25F7 and a molecular weight of 494.49 g/mol. Its IUPAC name is 2-[3,5-difluoro-4-[(E)-3,3,3-trifluoroprop-1-enyl]phenyl]-1,3-difluoro-5-(4-heptylphenyl)benzene.
| Compound Name | 2-[3,5-difluoro-4-[(E)-3,3,3-trifluoroprop-1-enyl]phenyl]-1,3-difluoro-5-(4-heptylphenyl)benzene |
|---|---|
| PubChem CID | 59247155 |
| Molecular Formula | C28H25F7 |
| Molecular Weight | 494.49 g/mol |
| Exact Mass | 494.18 |
| IUPAC Name | 2-[3,5-difluoro-4-[(E)-3,3,3-trifluoroprop-1-enyl]phenyl]-1,3-difluoro-5-(4-heptylphenyl)benzene |
| SMILES | CCCCCCCc1ccc(-c2cc(F)c(-c3cc(F)c(/C=C/C(F)(F)F)c(F)c3)c(F)c2)cc1 |
| InChI | InChI=1S/C28H25F7/c1-2-3-4-5-6-7-18-8-10-19(11-9-18)20-14-25(31)27(26(32)15-20)21-16-23(29)22(24(30)17-21)12-13-28(33,34)35/h8-17H,2-7H2,1H3/b13-12+ |
| InChIKey | RUGZRPDRYLNGCU-OUKQBFOZSA-N |
| XLogP | 9.67 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.49 |
| LogP ≤ 5 | 9.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|