C27H22F6O2 — CID 59247696
[4-[3,5-difluoro-4-[(E)-3,3,3-trifluoroprop-1-enyl]phenyl]-3-fluorophenyl] 4-pentylbenzoate (PubChem CID 59247696) has the molecular formula C27H22F6O2 and a molecular weight of 492.46 g/mol. Its IUPAC name is [4-[3,5-difluoro-4-[(E)-3,3,3-trifluoroprop-1-enyl]phenyl]-3-fluorophenyl] 4-pentylbenzoate.
| Compound Name | [4-[3,5-difluoro-4-[(E)-3,3,3-trifluoroprop-1-enyl]phenyl]-3-fluorophenyl] 4-pentylbenzoate |
|---|---|
| PubChem CID | 59247696 |
| Molecular Formula | C27H22F6O2 |
| Molecular Weight | 492.46 g/mol |
| Exact Mass | 492.15 |
| IUPAC Name | [4-[3,5-difluoro-4-[(E)-3,3,3-trifluoroprop-1-enyl]phenyl]-3-fluorophenyl] 4-pentylbenzoate |
| SMILES | CCCCCc1ccc(C(=O)Oc2ccc(-c3cc(F)c(/C=C/C(F)(F)F)c(F)c3)c(F)c2)cc1 |
| InChI | InChI=1S/C27H22F6O2/c1-2-3-4-5-17-6-8-18(9-7-17)26(34)35-20-10-11-21(25(30)16-20)19-14-23(28)22(24(29)15-19)12-13-27(31,32)33/h6-16H,2-5H2,1H3/b13-12+ |
| InChIKey | WEOZGQFFFDRDEG-OUKQBFOZSA-N |
| XLogP | 8.30 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.46 |
| LogP ≤ 5 | 8.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|