C25H23F5O2 — CID 139856181
[5,7-difluoro-6-(trifluoromethyl)naphthalen-2-yl] 4-heptylbenzoate (PubChem CID 139856181) has the molecular formula C25H23F5O2 and a molecular weight of 450.45 g/mol. Its IUPAC name is [5,7-difluoro-6-(trifluoromethyl)naphthalen-2-yl] 4-heptylbenzoate.
| Compound Name | [5,7-difluoro-6-(trifluoromethyl)naphthalen-2-yl] 4-heptylbenzoate |
|---|---|
| PubChem CID | 139856181 |
| Molecular Formula | C25H23F5O2 |
| Molecular Weight | 450.45 g/mol |
| Exact Mass | 450.16 |
| IUPAC Name | [5,7-difluoro-6-(trifluoromethyl)naphthalen-2-yl] 4-heptylbenzoate |
| SMILES | CCCCCCCc1ccc(C(=O)Oc2ccc3c(F)c(C(F)(F)F)c(F)cc3c2)cc1 |
| InChI | InChI=1S/C25H23F5O2/c1-2-3-4-5-6-7-16-8-10-17(11-9-16)24(31)32-19-12-13-20-18(14-19)15-21(26)22(23(20)27)25(28,29)30/h8-15H,2-7H2,1H3 |
| InChIKey | GABWNYTUOGFLPU-UHFFFAOYSA-N |
| XLogP | 7.87 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.45 |
| LogP ≤ 5 | 7.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|