C25H22F3NO2 — CID 139817608
(6-cyano-5,7-difluoronaphthalen-2-yl) 2-fluoro-4-heptylbenzoate (PubChem CID 139817608) has the molecular formula C25H22F3NO2 and a molecular weight of 425.45 g/mol. Its IUPAC name is (6-cyano-5,7-difluoronaphthalen-2-yl) 2-fluoro-4-heptylbenzoate.
| Compound Name | (6-cyano-5,7-difluoronaphthalen-2-yl) 2-fluoro-4-heptylbenzoate |
|---|---|
| PubChem CID | 139817608 |
| Molecular Formula | C25H22F3NO2 |
| Molecular Weight | 425.45 g/mol |
| Exact Mass | 425.16 |
| IUPAC Name | (6-cyano-5,7-difluoronaphthalen-2-yl) 2-fluoro-4-heptylbenzoate |
| SMILES | CCCCCCCc1ccc(C(=O)Oc2ccc3c(F)c(C#N)c(F)cc3c2)c(F)c1 |
| InChI | InChI=1S/C25H22F3NO2/c1-2-3-4-5-6-7-16-8-10-20(22(26)12-16)25(30)31-18-9-11-19-17(13-18)14-23(27)21(15-29)24(19)28/h8-14H,2-7H2,1H3 |
| InChIKey | AERWMNHQLJEEOU-UHFFFAOYSA-N |
| XLogP | 6.86 |
| TPSA | 50.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.45 |
| LogP ≤ 5 | 6.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|