C22H16F3NO2 — CID 139817580
(6-cyano-5,7-difluoronaphthalen-2-yl) 4-butyl-2-fluorobenzoate (PubChem CID 139817580) has the molecular formula C22H16F3NO2 and a molecular weight of 383.37 g/mol. Its IUPAC name is (6-cyano-5,7-difluoronaphthalen-2-yl) 4-butyl-2-fluorobenzoate.
| Compound Name | (6-cyano-5,7-difluoronaphthalen-2-yl) 4-butyl-2-fluorobenzoate |
|---|---|
| PubChem CID | 139817580 |
| Molecular Formula | C22H16F3NO2 |
| Molecular Weight | 383.37 g/mol |
| Exact Mass | 383.11 |
| IUPAC Name | (6-cyano-5,7-difluoronaphthalen-2-yl) 4-butyl-2-fluorobenzoate |
| SMILES | CCCCc1ccc(C(=O)Oc2ccc3c(F)c(C#N)c(F)cc3c2)c(F)c1 |
| InChI | InChI=1S/C22H16F3NO2/c1-2-3-4-13-5-7-17(19(23)9-13)22(27)28-15-6-8-16-14(10-15)11-20(24)18(12-26)21(16)25/h5-11H,2-4H2,1H3 |
| InChIKey | ZIHQPNWZHQISEU-UHFFFAOYSA-N |
| XLogP | 5.69 |
| TPSA | 50.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.37 |
| LogP ≤ 5 | 5.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|