C29H24F3NO2 — CID 139883264
(4-cyano-3-fluorophenyl) 1,3-difluoro-7-heptylphenanthrene-2-carboxylate (PubChem CID 139883264) has the molecular formula C29H24F3NO2 and a molecular weight of 475.51 g/mol. Its IUPAC name is (4-cyano-3-fluorophenyl) 1,3-difluoro-7-heptylphenanthrene-2-carboxylate.
| Compound Name | (4-cyano-3-fluorophenyl) 1,3-difluoro-7-heptylphenanthrene-2-carboxylate |
|---|---|
| PubChem CID | 139883264 |
| Molecular Formula | C29H24F3NO2 |
| Molecular Weight | 475.51 g/mol |
| Exact Mass | 475.18 |
| IUPAC Name | (4-cyano-3-fluorophenyl) 1,3-difluoro-7-heptylphenanthrene-2-carboxylate |
| SMILES | CCCCCCCc1ccc2c(ccc3c(F)c(C(=O)Oc4ccc(C#N)c(F)c4)c(F)cc32)c1 |
| InChI | InChI=1S/C29H24F3NO2/c1-2-3-4-5-6-7-18-8-12-22-19(14-18)10-13-23-24(22)16-26(31)27(28(23)32)29(34)35-21-11-9-20(17-33)25(30)15-21/h8-16H,2-7H2,1H3 |
| InChIKey | BEKHOCGVSRZCTF-UHFFFAOYSA-N |
| XLogP | 8.01 |
| TPSA | 50.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.51 |
| LogP ≤ 5 | 8.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|