C22H17F3O2 — CID 139853957
(6,7-difluoronaphthalen-2-yl) 2-fluoro-4-[(E)-pent-3-enyl]benzoate (PubChem CID 139853957) has the molecular formula C22H17F3O2 and a molecular weight of 370.37 g/mol. Its IUPAC name is (6,7-difluoronaphthalen-2-yl) 2-fluoro-4-[(E)-pent-3-enyl]benzoate.
| Compound Name | (6,7-difluoronaphthalen-2-yl) 2-fluoro-4-[(E)-pent-3-enyl]benzoate |
|---|---|
| PubChem CID | 139853957 |
| Molecular Formula | C22H17F3O2 |
| Molecular Weight | 370.37 g/mol |
| Exact Mass | 370.12 |
| IUPAC Name | (6,7-difluoronaphthalen-2-yl) 2-fluoro-4-[(E)-pent-3-enyl]benzoate |
| SMILES | C/C=C/CCc1ccc(C(=O)Oc2ccc3cc(F)c(F)cc3c2)c(F)c1 |
| InChI | InChI=1S/C22H17F3O2/c1-2-3-4-5-14-6-9-18(19(23)10-14)22(26)27-17-8-7-15-12-20(24)21(25)13-16(15)11-17/h2-3,6-13H,4-5H2,1H3/b3-2+ |
| InChIKey | SJDLXIKTCDWOEL-NSCUHMNNSA-N |
| XLogP | 5.99 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.37 |
| LogP ≤ 5 | 5.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|