C18H13F5O2 — CID 89134626
[3-fluoro-4-[(E)-3,3,3-trifluoroprop-1-enyl]phenyl] 4-ethyl-2-fluorobenzoate (PubChem CID 89134626) has the molecular formula C18H13F5O2 and a molecular weight of 356.29 g/mol. Its IUPAC name is [3-fluoro-4-[(E)-3,3,3-trifluoroprop-1-enyl]phenyl] 4-ethyl-2-fluorobenzoate.
| Compound Name | [3-fluoro-4-[(E)-3,3,3-trifluoroprop-1-enyl]phenyl] 4-ethyl-2-fluorobenzoate |
|---|---|
| PubChem CID | 89134626 |
| Molecular Formula | C18H13F5O2 |
| Molecular Weight | 356.29 g/mol |
| Exact Mass | 356.08 |
| IUPAC Name | [3-fluoro-4-[(E)-3,3,3-trifluoroprop-1-enyl]phenyl] 4-ethyl-2-fluorobenzoate |
| SMILES | CCc1ccc(C(=O)Oc2ccc(/C=C/C(F)(F)F)c(F)c2)c(F)c1 |
| InChI | InChI=1S/C18H13F5O2/c1-2-11-3-6-14(16(20)9-11)17(24)25-13-5-4-12(15(19)10-13)7-8-18(21,22)23/h3-10H,2H2,1H3/b8-7+ |
| InChIKey | NQQZZUKUFZZRDO-BQYQJAHWSA-N |
| XLogP | 5.32 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.29 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|