C19H14F6O2 — CID 59247444
[3,5-difluoro-4-[(E)-3,3,3-trifluoroprop-1-enyl]phenyl] 2-fluoro-4-propylbenzoate (PubChem CID 59247444) has the molecular formula C19H14F6O2 and a molecular weight of 388.31 g/mol. Its IUPAC name is [3,5-difluoro-4-[(E)-3,3,3-trifluoroprop-1-enyl]phenyl] 2-fluoro-4-propylbenzoate.
| Compound Name | [3,5-difluoro-4-[(E)-3,3,3-trifluoroprop-1-enyl]phenyl] 2-fluoro-4-propylbenzoate |
|---|---|
| PubChem CID | 59247444 |
| Molecular Formula | C19H14F6O2 |
| Molecular Weight | 388.31 g/mol |
| Exact Mass | 388.09 |
| IUPAC Name | [3,5-difluoro-4-[(E)-3,3,3-trifluoroprop-1-enyl]phenyl] 2-fluoro-4-propylbenzoate |
| SMILES | CCCc1ccc(C(=O)Oc2cc(F)c(/C=C/C(F)(F)F)c(F)c2)c(F)c1 |
| InChI | InChI=1S/C19H14F6O2/c1-2-3-11-4-5-14(15(20)8-11)18(26)27-12-9-16(21)13(17(22)10-12)6-7-19(23,24)25/h4-10H,2-3H2,1H3/b7-6+ |
| InChIKey | UCDLAJDFVXNBQJ-VOTSOKGWSA-N |
| XLogP | 5.85 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.31 |
| LogP ≤ 5 | 5.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|