C29H17F7O2 — CID 162555892
[4-[3,5-difluoro-4-[(E)-3,3,3-trifluoroprop-1-enyl]phenyl]-3,5-difluorophenyl] 4-(4-methylphenyl)benzoate (PubChem CID 162555892) has the molecular formula C29H17F7O2 and a molecular weight of 530.44 g/mol. Its IUPAC name is [4-[3,5-difluoro-4-[(E)-3,3,3-trifluoroprop-1-enyl]phenyl]-3,5-difluorophenyl] 4-(4-methylphenyl)benzoate.
| Compound Name | [4-[3,5-difluoro-4-[(E)-3,3,3-trifluoroprop-1-enyl]phenyl]-3,5-difluorophenyl] 4-(4-methylphenyl)benzoate |
|---|---|
| PubChem CID | 162555892 |
| Molecular Formula | C29H17F7O2 |
| Molecular Weight | 530.44 g/mol |
| Exact Mass | 530.11 |
| IUPAC Name | [4-[3,5-difluoro-4-[(E)-3,3,3-trifluoroprop-1-enyl]phenyl]-3,5-difluorophenyl] 4-(4-methylphenyl)benzoate |
| SMILES | Cc1ccc(-c2ccc(C(=O)Oc3cc(F)c(-c4cc(F)c(/C=C/C(F)(F)F)c(F)c4)c(F)c3)cc2)cc1 |
| InChI | InChI=1S/C29H17F7O2/c1-16-2-4-17(5-3-16)18-6-8-19(9-7-18)28(37)38-21-14-25(32)27(26(33)15-21)20-12-23(30)22(24(31)13-20)10-11-29(34,35)36/h2-15H,1H3/b11-10+ |
| InChIKey | VEWIPOFCFBJHFE-ZHACJKMWSA-N |
| XLogP | 8.68 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.44 |
| LogP ≤ 5 | 8.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|