C25H18F6O3 — CID 123692276
[4-(3,3-difluoroprop-1-enoxy)-3,5-difluorophenyl] 2-fluoro-4-(2-fluoro-4-propylphenyl)benzoate (PubChem CID 123692276) has the molecular formula C25H18F6O3 and a molecular weight of 480.40 g/mol. Its IUPAC name is [4-(3,3-difluoroprop-1-enoxy)-3,5-difluorophenyl] 2-fluoro-4-(2-fluoro-4-propylphenyl)benzoate.
| Compound Name | [4-(3,3-difluoroprop-1-enoxy)-3,5-difluorophenyl] 2-fluoro-4-(2-fluoro-4-propylphenyl)benzoate |
|---|---|
| PubChem CID | 123692276 |
| Molecular Formula | C25H18F6O3 |
| Molecular Weight | 480.40 g/mol |
| Exact Mass | 480.12 |
| IUPAC Name | [4-(3,3-difluoroprop-1-enoxy)-3,5-difluorophenyl] 2-fluoro-4-(2-fluoro-4-propylphenyl)benzoate |
| SMILES | CCCc1ccc(-c2ccc(C(=O)Oc3cc(F)c(OC=CC(F)F)c(F)c3)c(F)c2)c(F)c1 |
| InChI | InChI=1S/C25H18F6O3/c1-2-3-14-4-6-17(19(26)10-14)15-5-7-18(20(27)11-15)25(32)34-16-12-21(28)24(22(29)13-16)33-9-8-23(30)31/h4-13,23H,2-3H2,1H3 |
| InChIKey | NURHBDWCXAIGNK-UHFFFAOYSA-N |
| XLogP | 7.24 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.40 |
| LogP ≤ 5 | 7.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|