C29H23F4NO — CID 123713603
2-[4-[4-[4-(3,3-difluoroprop-1-enoxy)-3,5-difluorophenyl]phenyl]phenyl]-5-propylpyridine (PubChem CID 123713603) has the molecular formula C29H23F4NO and a molecular weight of 477.50 g/mol. Its IUPAC name is 2-[4-[4-[4-(3,3-difluoroprop-1-enoxy)-3,5-difluorophenyl]phenyl]phenyl]-5-propylpyridine.
| Compound Name | 2-[4-[4-[4-(3,3-difluoroprop-1-enoxy)-3,5-difluorophenyl]phenyl]phenyl]-5-propylpyridine |
|---|---|
| PubChem CID | 123713603 |
| Molecular Formula | C29H23F4NO |
| Molecular Weight | 477.50 g/mol |
| Exact Mass | 477.17 |
| IUPAC Name | 2-[4-[4-[4-(3,3-difluoroprop-1-enoxy)-3,5-difluorophenyl]phenyl]phenyl]-5-propylpyridine |
| SMILES | CCCc1ccc(-c2ccc(-c3ccc(-c4cc(F)c(OC=CC(F)F)c(F)c4)cc3)cc2)nc1 |
| InChI | InChI=1S/C29H23F4NO/c1-2-3-19-4-13-27(34-18-19)23-11-9-21(10-12-23)20-5-7-22(8-6-20)24-16-25(30)29(26(31)17-24)35-15-14-28(32)33/h4-18,28H,2-3H2,1H3 |
| InChIKey | CDMBEFNONDZPCJ-UHFFFAOYSA-N |
| XLogP | 8.47 |
| TPSA | 22.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.50 |
| LogP ≤ 5 | 8.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|