C23H22F3NO — CID 58383763
2-[4-[3,5-difluoro-4-(fluoromethoxy)phenyl]phenyl]-5-pentylpyridine (PubChem CID 58383763) has the molecular formula C23H22F3NO and a molecular weight of 385.43 g/mol. Its IUPAC name is 2-[4-[3,5-difluoro-4-(fluoromethoxy)phenyl]phenyl]-5-pentylpyridine.
| Compound Name | 2-[4-[3,5-difluoro-4-(fluoromethoxy)phenyl]phenyl]-5-pentylpyridine |
|---|---|
| PubChem CID | 58383763 |
| Molecular Formula | C23H22F3NO |
| Molecular Weight | 385.43 g/mol |
| Exact Mass | 385.17 |
| IUPAC Name | 2-[4-[3,5-difluoro-4-(fluoromethoxy)phenyl]phenyl]-5-pentylpyridine |
| SMILES | CCCCCc1ccc(-c2ccc(-c3cc(F)c(OCF)c(F)c3)cc2)nc1 |
| InChI | InChI=1S/C23H22F3NO/c1-2-3-4-5-16-6-11-22(27-14-16)18-9-7-17(8-10-18)19-12-20(25)23(28-15-24)21(26)13-19/h6-14H,2-5,15H2,1H3 |
| InChIKey | KISVHGMGWWIIGL-UHFFFAOYSA-N |
| XLogP | 6.73 |
| TPSA | 22.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.43 |
| LogP ≤ 5 | 6.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|