C21H26F2O — CID 67842427
2-butoxy-1,3-difluoro-5-(4-pentylphenyl)benzene (PubChem CID 67842427) has the molecular formula C21H26F2O and a molecular weight of 332.43 g/mol. Its IUPAC name is 2-butoxy-1,3-difluoro-5-(4-pentylphenyl)benzene.
| Compound Name | 2-butoxy-1,3-difluoro-5-(4-pentylphenyl)benzene |
|---|---|
| PubChem CID | 67842427 |
| Molecular Formula | C21H26F2O |
| Molecular Weight | 332.43 g/mol |
| Exact Mass | 332.20 |
| IUPAC Name | 2-butoxy-1,3-difluoro-5-(4-pentylphenyl)benzene |
| SMILES | CCCCCc1ccc(-c2cc(F)c(OCCCC)c(F)c2)cc1 |
| InChI | InChI=1S/C21H26F2O/c1-3-5-7-8-16-9-11-17(12-10-16)18-14-19(22)21(20(23)15-18)24-13-6-4-2/h9-12,14-15H,3-8,13H2,1-2H3 |
| InChIKey | RQBYBIMLYCYISR-UHFFFAOYSA-N |
| XLogP | 6.54 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.43 |
| LogP ≤ 5 | 6.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|