C19H22F2O — CID 18552265
2-[2,6-difluoro-4-(4-pentylphenyl)phenyl]ethanol (PubChem CID 18552265) has the molecular formula C19H22F2O and a molecular weight of 304.38 g/mol. Its IUPAC name is 2-[2,6-difluoro-4-(4-pentylphenyl)phenyl]ethanol.
| Compound Name | 2-[2,6-difluoro-4-(4-pentylphenyl)phenyl]ethanol |
|---|---|
| PubChem CID | 18552265 |
| Molecular Formula | C19H22F2O |
| Molecular Weight | 304.38 g/mol |
| Exact Mass | 304.16 |
| IUPAC Name | 2-[2,6-difluoro-4-(4-pentylphenyl)phenyl]ethanol |
| SMILES | CCCCCc1ccc(-c2cc(F)c(CCO)c(F)c2)cc1 |
| InChI | InChI=1S/C19H22F2O/c1-2-3-4-5-14-6-8-15(9-7-14)16-12-18(20)17(10-11-22)19(21)13-16/h6-9,12-13,22H,2-5,10-11H2,1H3 |
| InChIKey | JLOMRTKYRVWVSS-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.38 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|