C23H21F3O — CID 90163478
5-[4-[4-(3,4,5-trifluorophenyl)phenyl]phenyl]pentan-1-ol (PubChem CID 90163478) has the molecular formula C23H21F3O and a molecular weight of 370.41 g/mol. Its IUPAC name is 5-[4-[4-(3,4,5-trifluorophenyl)phenyl]phenyl]pentan-1-ol.
| Compound Name | 5-[4-[4-(3,4,5-trifluorophenyl)phenyl]phenyl]pentan-1-ol |
|---|---|
| PubChem CID | 90163478 |
| Molecular Formula | C23H21F3O |
| Molecular Weight | 370.41 g/mol |
| Exact Mass | 370.15 |
| IUPAC Name | 5-[4-[4-(3,4,5-trifluorophenyl)phenyl]phenyl]pentan-1-ol |
| SMILES | OCCCCCc1ccc(-c2ccc(-c3cc(F)c(F)c(F)c3)cc2)cc1 |
| InChI | InChI=1S/C23H21F3O/c24-21-14-20(15-22(25)23(21)26)19-11-9-18(10-12-19)17-7-5-16(6-8-17)4-2-1-3-13-27/h5-12,14-15,27H,1-4,13H2 |
| InChIKey | UGMWRNSKRATXPD-UHFFFAOYSA-N |
| XLogP | 6.14 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.41 |
| LogP ≤ 5 | 6.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|