C35H30F4N2 — CID 134602760
4-[4-[9-[4-(4-cyano-3,5-difluorophenyl)phenyl]nonyl]phenyl]-2,6-difluorobenzonitrile (PubChem CID 134602760) has the molecular formula C35H30F4N2 and a molecular weight of 554.63 g/mol. Its IUPAC name is 4-[4-[9-[4-(4-cyano-3,5-difluorophenyl)phenyl]nonyl]phenyl]-2,6-difluorobenzonitrile.
| Compound Name | 4-[4-[9-[4-(4-cyano-3,5-difluorophenyl)phenyl]nonyl]phenyl]-2,6-difluorobenzonitrile |
|---|---|
| PubChem CID | 134602760 |
| Molecular Formula | C35H30F4N2 |
| Molecular Weight | 554.63 g/mol |
| Exact Mass | 554.23 |
| IUPAC Name | 4-[4-[9-[4-(4-cyano-3,5-difluorophenyl)phenyl]nonyl]phenyl]-2,6-difluorobenzonitrile |
| SMILES | N#Cc1c(F)cc(-c2ccc(CCCCCCCCCc3ccc(-c4cc(F)c(C#N)c(F)c4)cc3)cc2)cc1F |
| InChI | InChI=1S/C35H30F4N2/c36-32-18-28(19-33(37)30(32)22-40)26-14-10-24(11-15-26)8-6-4-2-1-3-5-7-9-25-12-16-27(17-13-25)29-20-34(38)31(23-41)35(39)21-29/h10-21H,1-9H2 |
| InChIKey | QJLXHNYPKMSHEL-UHFFFAOYSA-N |
| XLogP | 9.84 |
| TPSA | 47.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.63 |
| LogP ≤ 5 | 9.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|