C22H18F2N2 — CID 70362901
4-[5-(4-butylphenyl)-2-pyridinyl]-2,6-difluorobenzonitrile (PubChem CID 70362901) has the molecular formula C22H18F2N2 and a molecular weight of 348.40 g/mol. Its IUPAC name is 4-[5-(4-butylphenyl)-2-pyridinyl]-2,6-difluorobenzonitrile.
| Compound Name | 4-[5-(4-butylphenyl)-2-pyridinyl]-2,6-difluorobenzonitrile |
|---|---|
| PubChem CID | 70362901 |
| Molecular Formula | C22H18F2N2 |
| Molecular Weight | 348.40 g/mol |
| Exact Mass | 348.14 |
| IUPAC Name | 4-[5-(4-butylphenyl)-2-pyridinyl]-2,6-difluorobenzonitrile |
| SMILES | CCCCc1ccc(-c2ccc(-c3cc(F)c(C#N)c(F)c3)nc2)cc1 |
| InChI | InChI=1S/C22H18F2N2/c1-2-3-4-15-5-7-16(8-6-15)17-9-10-22(26-14-17)18-11-20(23)19(13-25)21(24)12-18/h5-12,14H,2-4H2,1H3 |
| InChIKey | VCPUJBCTXCAUOL-UHFFFAOYSA-N |
| XLogP | 5.91 |
| TPSA | 36.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.40 |
| LogP ≤ 5 | 5.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |