C27H29F2N3 — CID 14618825
4-[5-(4-decylphenyl)pyrimidin-2-yl]-2,6-difluorobenzonitrile (PubChem CID 14618825) has the molecular formula C27H29F2N3 and a molecular weight of 433.55 g/mol. Its IUPAC name is 4-[5-(4-decylphenyl)pyrimidin-2-yl]-2,6-difluorobenzonitrile.
| Compound Name | 4-[5-(4-decylphenyl)pyrimidin-2-yl]-2,6-difluorobenzonitrile |
|---|---|
| PubChem CID | 14618825 |
| Molecular Formula | C27H29F2N3 |
| Molecular Weight | 433.55 g/mol |
| Exact Mass | 433.23 |
| IUPAC Name | 4-[5-(4-decylphenyl)pyrimidin-2-yl]-2,6-difluorobenzonitrile |
| SMILES | CCCCCCCCCCc1ccc(-c2cnc(-c3cc(F)c(C#N)c(F)c3)nc2)cc1 |
| InChI | InChI=1S/C27H29F2N3/c1-2-3-4-5-6-7-8-9-10-20-11-13-21(14-12-20)23-18-31-27(32-19-23)22-15-25(28)24(17-30)26(29)16-22/h11-16,18-19H,2-10H2,1H3 |
| InChIKey | GWXCWMIFDPNFKA-UHFFFAOYSA-N |
| XLogP | 7.64 |
| TPSA | 49.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.55 |
| LogP ≤ 5 | 7.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|