C27H29F2N3O — CID 14618837
4-[5-(4-decoxyphenyl)pyrimidin-2-yl]-2,6-difluorobenzonitrile (PubChem CID 14618837) has the molecular formula C27H29F2N3O and a molecular weight of 449.55 g/mol. Its IUPAC name is 4-[5-(4-decoxyphenyl)pyrimidin-2-yl]-2,6-difluorobenzonitrile.
| Compound Name | 4-[5-(4-decoxyphenyl)pyrimidin-2-yl]-2,6-difluorobenzonitrile |
|---|---|
| PubChem CID | 14618837 |
| Molecular Formula | C27H29F2N3O |
| Molecular Weight | 449.55 g/mol |
| Exact Mass | 449.23 |
| IUPAC Name | 4-[5-(4-decoxyphenyl)pyrimidin-2-yl]-2,6-difluorobenzonitrile |
| SMILES | CCCCCCCCCCOc1ccc(-c2cnc(-c3cc(F)c(C#N)c(F)c3)nc2)cc1 |
| InChI | InChI=1S/C27H29F2N3O/c1-2-3-4-5-6-7-8-9-14-33-23-12-10-20(11-13-23)22-18-31-27(32-19-22)21-15-25(28)24(17-30)26(29)16-21/h10-13,15-16,18-19H,2-9,14H2,1H3 |
| InChIKey | KDVUOCUFNXTIJI-UHFFFAOYSA-N |
| XLogP | 7.48 |
| TPSA | 58.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.55 |
| LogP ≤ 5 | 7.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|