C28H24F3N — CID 22044556
2,6-difluoro-4-(1-fluoro-7-heptylphenanthren-2-yl)benzonitrile (PubChem CID 22044556) has the molecular formula C28H24F3N and a molecular weight of 431.50 g/mol. Its IUPAC name is 2,6-difluoro-4-(1-fluoro-7-heptylphenanthren-2-yl)benzonitrile.
| Compound Name | 2,6-difluoro-4-(1-fluoro-7-heptylphenanthren-2-yl)benzonitrile |
|---|---|
| PubChem CID | 22044556 |
| Molecular Formula | C28H24F3N |
| Molecular Weight | 431.50 g/mol |
| Exact Mass | 431.19 |
| IUPAC Name | 2,6-difluoro-4-(1-fluoro-7-heptylphenanthren-2-yl)benzonitrile |
| SMILES | CCCCCCCc1ccc2c(ccc3c(F)c(-c4cc(F)c(C#N)c(F)c4)ccc32)c1 |
| InChI | InChI=1S/C28H24F3N/c1-2-3-4-5-6-7-18-8-10-21-19(14-18)9-11-24-23(21)13-12-22(28(24)31)20-15-26(29)25(17-32)27(30)16-20/h8-16H,2-7H2,1H3 |
| InChIKey | SYNFJIKWAQUWQE-UHFFFAOYSA-N |
| XLogP | 8.46 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.50 |
| LogP ≤ 5 | 8.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|