C22H14ClF3 — CID 139884406
2-(4-chloro-3,5-difluorophenyl)-7-ethyl-1-fluorophenanthrene (PubChem CID 139884406) has the molecular formula C22H14ClF3 and a molecular weight of 370.80 g/mol. Its IUPAC name is 2-(4-chloro-3,5-difluorophenyl)-7-ethyl-1-fluorophenanthrene.
| Compound Name | 2-(4-chloro-3,5-difluorophenyl)-7-ethyl-1-fluorophenanthrene |
|---|---|
| PubChem CID | 139884406 |
| Molecular Formula | C22H14ClF3 |
| Molecular Weight | 370.80 g/mol |
| Exact Mass | 370.07 |
| IUPAC Name | 2-(4-chloro-3,5-difluorophenyl)-7-ethyl-1-fluorophenanthrene |
| SMILES | CCc1ccc2c(ccc3c(F)c(-c4cc(F)c(Cl)c(F)c4)ccc32)c1 |
| InChI | InChI=1S/C22H14ClF3/c1-2-12-3-5-15-13(9-12)4-6-18-17(15)8-7-16(22(18)26)14-10-19(24)21(23)20(25)11-14/h3-11H,2H2,1H3 |
| InChIKey | JPCAERHNJXSCGX-UHFFFAOYSA-N |
| XLogP | 7.29 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.80 |
| LogP ≤ 5 | 7.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|