C20H13ClF2 — CID 139851509
2-[2-(4-chloro-3-fluorophenyl)ethynyl]-6-ethyl-1-fluoronaphthalene (PubChem CID 139851509) has the molecular formula C20H13ClF2 and a molecular weight of 326.77 g/mol. Its IUPAC name is 2-[2-(4-chloro-3-fluorophenyl)ethynyl]-6-ethyl-1-fluoronaphthalene.
| Compound Name | 2-[2-(4-chloro-3-fluorophenyl)ethynyl]-6-ethyl-1-fluoronaphthalene |
|---|---|
| PubChem CID | 139851509 |
| Molecular Formula | C20H13ClF2 |
| Molecular Weight | 326.77 g/mol |
| Exact Mass | 326.07 |
| IUPAC Name | 2-[2-(4-chloro-3-fluorophenyl)ethynyl]-6-ethyl-1-fluoronaphthalene |
| SMILES | CCc1ccc2c(F)c(C#Cc3ccc(Cl)c(F)c3)ccc2c1 |
| InChI | InChI=1S/C20H13ClF2/c1-2-13-4-9-17-16(11-13)8-7-15(20(17)23)6-3-14-5-10-18(21)19(22)12-14/h4-5,7-12H,2H2,1H3 |
| InChIKey | OCPBJDMWDMNWRC-UHFFFAOYSA-N |
| XLogP | 5.73 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.77 |
| LogP ≤ 5 | 5.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|